Fenoxycarb | |
---|---|
ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate
|
|
Other names
Varikill, Insegar, Logic
|
|
Identifiers | |
CAS number | 72490-01-8 |
PubChem | 51605 |
ChemSpider | 46739 |
O=C(OCC)NCCOc2ccc(Oc1ccccc1)cc2
|
|
InChI=1S/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19)
Key: HJUFTIJOISQSKQ-UHFFFAOYSA-N InChI=1/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19) Key: HJUFTIJOISQSKQ-UHFFFAOYAM |
|
Properties | |
Molecular formula | C17H19NO4 |
Molar mass | 301.34 g/mol |
Melting point |
53.5 °C, 327 K, 128 °F |
(what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
Infobox references |
Fenoxycarb is a carbamate insecticide. It has a low toxicity for bees, birds, and humans, but is toxic to fish.
References
External links
|