Transfluthrin | |
---|---|
(1R,3S)-3-(2,2-Dichlorovinyl)-2,2-dimethyl-1-cyclopropanecarboxylic acid (2,3,5,6-tetrafluorophenyl)methyl ester
|
|
Identifiers | |
CAS number | 118712-89-3 |
PubChem | 656612 |
SMILES |
CC1(C(C1C(=O)OCC2=C(C(=CC(=C2F)F)F)F)C=C(Cl)Cl)C
|
Properties | |
Molecular formula | C15H12Cl2F4O2 |
Molar mass | 371.15 g/mol |
Appearance | Colourless crystals |
Density | 1.507 g/cm3 (23 °C) |
Melting point |
32 °C, 305 K, 90 °F |
Boiling point |
135 °C/0.1 mmHg |
Solubility in water | 5.7–10.5 g/L |
Solubility in hexane, isopropanol, toluene, dichloromethane | very soluble |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Infobox references |
Transfluthrin is a fast-acting pyrethroid insecticide with low persistency. It has the molecular formula C15H12Cl2F4O2. Transfluthrin can be used in the indoor environment against flies, mosquitoes and cockroaches. It is a relatively volatile substance and acts as a contact and inhalation agent.