{{Drugbox
| verifiedrevid = 464380960
| IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate
| image = Rescinnamine.svg
| width = 300
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = oral
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| IUPHAR_ligand = 7098
| CAS_number_Ref =
| CAS_number = 24815-24-5
| ATC_prefix = C02
| ATC_suffix = AA01
| ATC_supplemental =
| PubChem = 5280954
| DrugBank_Ref =
| DrugBank = DB01180
| ChemSpiderID_Ref =
| ChemSpiderID = 4444446
| UNII_Ref =
| UNII = Q6W1F7DJ2D
| KEGG_Ref =
| KEGG = D00198
| ChEBI_Ref =
| ChEBI = 28572
| ChEMBL_Ref =
| ChEMBL = 1668
| C=35 | H=42 | N=2 | O=9
| molecular_weight = 634.716 g/mol
| smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC
| InChI = 1/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1
| InChIKey = SZLZWPPUNLXJEA-QEGASFHIBN
| StdInChI_Ref =
| StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N
| synonyms = methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate
}}
Rescinnamine is an angiotensin-converting enzyme inhibitor used as an antihypertensive drug.
It is an vinca alkaloid obtained from Rauwolfia serpentina[1] and other species of Rauwolfia.[2]
Brand names
Moderil, Cinnasil, Anaprel
References
- ^ FIFE R, MACLAURIN JC, WRIGHT JH (December 1960). "Rescinnamine in treatment of hypertension in hospital clinic and in general practice". British Medical Journal. 2 (5216): 1848–50. doi:10.1136/bmj.2.5216.1848. PMC 2098607. PMID 13699407.
{{cite journal}}
: CS1 maint: multiple names: authors list (link) - ^ Balsevich J, Constabel F, Kurz WG. (1982). "Alkaloids of Vinca major cv. Variegata". Planta Med. 44 (2): 91–3. doi:10.1055/s-2007-971409. PMID 17402086.
{{cite journal}}
: CS1 maint: multiple names: authors list (link)