m Journal cites (journal names):, using AWB (8060) |
m replaced secondary with primary DrugBank accession number per talk |
||
Line 27: | Line 27: | ||
| PubChem = 5280954 |
| PubChem = 5280954 |
||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
||
| DrugBank = |
| DrugBank = DB01180 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4444446 |
| ChemSpiderID = 4444446 |
Revision as of 16:38, 13 April 2012
{{Drugbox | Verifiedfields = changed | verifiedrevid = 464380960 | IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate | image = Rescinnamine.svg | width = 300
| tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oral
| bioavailability = | protein_bound = | metabolism = | elimination_half-life =
| CASNo_Ref = | CAS_number_Ref = | CAS_number = 24815-24-5 | ATC_prefix = C02 | ATC_suffix = AA01 | ATC_supplemental = | PubChem = 5280954 | DrugBank_Ref =
| DrugBank = DB01180
| ChemSpiderID_Ref = | ChemSpiderID = 4444446 | UNII_Ref = | UNII = Q6W1F7DJ2D | KEGG_Ref = | KEGG = D00198 | ChEBI_Ref = | ChEBI = 28572 | ChEMBL_Ref = | ChEMBL = 1668
| C=35 | H=42 | N=2 | O=9 | molecular_weight = 634.716 g/mol | smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC | InChI = 1/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | InChIKey = SZLZWPPUNLXJEA-QEGASFHIBN | StdInChI_Ref = | StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N | synonyms = methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate }} Rescinnamine is an angiotensin-converting enzyme inhibitor used as an antihypertensive drug.
It is an alkaloid obtained from Rauwolfia serpentina[1] and other species of Rauwolfia.
Brand names
Moderil, Cinnasil, Anaprel
References
- ^ FIFE R, MACLAURIN JC, WRIGHT JH (1960). "Rescinnamine in treatment of hypertension in hospital clinic and in general practice". British Medical Journal. 2 (5216): 1848–50. doi:10.1136/bmj.2.5216.1848. PMC 2098607. PMID 13699407.
{{cite journal}}
: Unknown parameter|month=
ignored (help)CS1 maint: multiple names: authors list (link)