Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1 InChIKey1. |
No edit summary |
||
Line 1: | Line 1: | ||
{{drugbox |
{{drugbox |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = Q6W1F7DJ2D |
|||
| verifiedrevid = 408987920 |
| verifiedrevid = 408987920 |
||
| IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2''E'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate |
| IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2''E'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate |
Revision as of 03:29, 1 July 2011
{{drugbox | UNII_Ref = | UNII = Q6W1F7DJ2D | verifiedrevid = 408987920 | IUPAC_name = methyl (3β,16β,17α,18β,20α)-11,17-dimethoxy-18-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}yohimban-16-carboxylate |synonyms = methyl (1R,15S,17R,18R,19S,20S)-6,18-dimethoxy-17-{[(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate | image = Rescinnamine.svg | CASNo_Ref = | ChemSpiderID_Ref = | ChemSpiderID = 4444446 | InChI = 1/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | InChIKey = SZLZWPPUNLXJEA-QEGASFHIBN | smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC | ChEMBL_Ref = | ChEMBL = 1668 | StdInChI_Ref = | StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N | InChI1 = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | InChIKey1 = SZLZWPPUNLXJEA-QEGASFHISA-N | CAS_number = 24815-24-5 | ATC_prefix = C02 | ATC_suffix = AA01 | ATC_supplemental = | PubChem = 5280954 | DrugBank = APRD00112 | KEGG_Ref = | KEGG = D00198 | C = 35 | H = 42 | N = 2 | O = 9 | molecular_weight = 634.716 g/mol | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oral }} Rescinnamine is an angiotensin-converting enzyme inhibitor used as an antihypertensive drug.
It is an alkaloid obtained from Rauwolfia serpentina[1] and other species of Rauwolfia.
Brand names
Moderil, Cinnasil, Anaprel
References
- ^ FIFE R, MACLAURIN JC, WRIGHT JH (1960). "Rescinnamine in treatment of hypertension in hospital clinic and in general practice". British medical journal. 2 (5216): 1848–50. doi:10.1136/bmj.2.5216.1848. PMC 2098607. PMID 13699407.
{{cite journal}}
: Unknown parameter|month=
ignored (help)CS1 maint: multiple names: authors list (link)