Vaccinationist (talk | contribs) mNo edit summary |
m Infobox drug: rm/replace deprecated params. Fix unk parameters (rm some Chembox-params) (via AWB script) |
||
Line 4: | Line 4: | ||
| IUPAC_name = 5-[(2''Z'')-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]-2-hydroxybenzoic acid |
| IUPAC_name = 5-[(2''Z'')-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]-2-hydroxybenzoic acid |
||
| image = Olsalazine.svg |
| image = Olsalazine.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = Dipentum |
| tradename = Dipentum |
||
Line 18: | Line 17: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
Line 25: | Line 23: | ||
| elimination_half-life = 0.9 hours |
| elimination_half-life = 0.9 hours |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 15722-48-2 |
| CAS_number = 15722-48-2 |
||
Line 43: | Line 39: | ||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
||
| ChEMBL = 571540 |
| ChEMBL = 571540 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
| chemical_formula = |
||
| C=14 | H=10 | N=2 | O=6 |
| C=14 | H=10 | N=2 | O=6 |
||
| molecular_weight = 302.239g/mol |
| molecular_weight = 302.239g/mol |
||
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2 |
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2 |
Revision as of 12:52, 28 June 2015
Clinical data | |
---|---|
Trade names | Dipentum |
AHFS/Drugs.com | Monograph |
MedlinePlus | a601088 |
ATC code | |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Protein binding | 99% |
Elimination half-life | 0.9 hours |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.116.494 |
Chemical and physical data | |
Formula | C14H10N2O6 |
Molar mass | 302.239g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Olsalazine is an anti-inflammatory drug used in the treatment of inflammatory bowel disease such as ulcerative colitis. It is sold under the name Dipentum.
The chemical name is 3,3' -azobis (6-hydroxybenzoate)salicylic acid. It is sold as the disodium salt.
Like balsalazide, olsalazine is believed to deliver mesalazine, or 5-aminosalicylic acid (5-ASA), past the small intestine, directly to the large intestine, which is the active site of disease in ulcerative colitis.
History
Olsalazine gained Food and Drug Administration (FDA) approval in 1990.
Supply
The drug is supplied by UCB Pharma.
Other indications
The Australian biotech company Giaconda has developed a combination therapy for treating constipation-predominant irritable bowel syndrome that uses olsalazine and the anti-gout drug colchicine.
External links