Updating {{drugbox}} (changes to verified and watched fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmac |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1:
{{
| Verifiedfields = changed
| Watchedfields = changed
Line 5:
| IUPAC_name = (''RS'')-''N''-(2,6-dimethylphenyl)- 1-methyl-piperidine-2-carboxamide
| image = Mepivacaine.png
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|CDI|mepivacaine}}
| MedlinePlus = a603026
| legal_status = ▼
| routes_of_administration = ▼
<!--Pharmacokinetic data-->
| bioavailability = ▼
| protein_bound = ▼
| metabolism = ▼
| elimination_half-life = ▼
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 96-88-8▼
| ATC_prefix = N01▼
| ATC_suffix = BB03▼
| ATC_supplemental = ▼
| PubChem = 4062▼
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}▼
| DrugBank = APRD01094▼
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3922
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = B6E06QE59J
| KEGG_Ref = {{keggcite|correct|kegg}}▼
| InChI = 1/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18)▼
| KEGG = D08181▼
| InChIKey = INWLQCZOYSRPNW-UHFFFAOYAD▼
| ChEBI_Ref = {{ebicite|changed|EBI}}▼
| smiles = O=C(Nc1c(cccc1C)C)C2N(C)CCCC2▼
| ChEBI = 6759▼
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1087
<!--Chemical data-->
| molecular_weight = 246.348 g/mol▼
▲| smiles = O=C(Nc1c(cccc1C)C)C2N(C)CCCC2
▲| InChI = 1/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18)
▲| InChIKey = INWLQCZOYSRPNW-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = INWLQCZOYSRPNW-UHFFFAOYSA-N
▲| CAS_number = 96-88-8
▲| ATC_prefix = N01
▲| ATC_suffix = BB03
▲| ATC_supplemental =
▲| ChEBI_Ref = {{ebicite|changed|EBI}}
▲| ChEBI = 6759
▲| PubChem = 4062
▲| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
▲| DrugBank = APRD01094
▲| KEGG_Ref = {{keggcite|correct|kegg}}
▲| KEGG = D08181
▲| C = 15 | H = 22 | N = 2 | O = 1
▲| molecular_weight = 246.348 g/mol
▲| bioavailability =
▲| protein_bound =
▲| metabolism =
▲| elimination_half-life =
▲| pregnancy_category = C, use w/ caution, may cause fetal bradycardia
▲| legal_status =
▲| routes_of_administration =
}}
|
Revision as of 07:50, 30 August 2011
Clinical data | |
---|---|
AHFS/Drugs.com | Consumer Drug Information |
MedlinePlus | a603026 |
Pregnancy category |
|
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.002.313 |
Chemical and physical data | |
Formula | C15H22N2O |
Molar mass | 246.348 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Mepivacaine (/[invalid input: 'icon']mɛˈpɪvəkeɪn/) is a local anesthetic[1] of the amide type. Mepivacaine has a reasonably rapid onset (more rapid than that of procaine) and medium duration of action (shorter than that of procaine) and is marketed under various trade names including Carbocaine and Polocaine.
Mepivacaine became available in the United States in the 1960s.
Mepivacaine is used in any infiltration and regional anesthesia.
It is supplied as the hydrochloride salt of the racemate.[2]
Chemistry
Two primary methods of synthesis have been suggested. According to the first, mepivacaine is synthesized by reacting the ethyl ester of 1-methylpiperindine-2-carboxylic acid with 2,6-dimethylanilinomagnesium bromide, which is synthesized from 2,6-dimethylaniline and ethylmagnesium bromide.
- E. Thuresson, H. Egner, U.S. patent 2,799,679 (1957).
- B.T. Ekenstam, B. von Egner, G. Petterson, Acta Chem. Scand., 11, 1183 (1957).
- Attention: This template ({{cite doi}}) is deprecated. To cite the publication identified by doi:10.1002/hlca.19590420430, please use {{cite journal}} (if it was published in a bona fide academic journal, otherwise {{cite report}} with
|doi=10.1002/hlca.19590420430
instead.
According to the second method, reacting 2,6-dimethylaniline with the acid chloride of pyridine- carboxylic acid first gives the 2,6-xylidide of α-picolinic acid. Then the aromatic pyridine ring is reduced to piperidine by hydrogen in the presence of a platinum on carbon catalyst. The resulting 2,6-xylidide α-pipecolic acid is methylated to mepivacaine using formaldehyde with simultaneous reduction by hydrogen in the presence of platinum on carbon catalyst.
- B.G. Petterson, U.S. patent 4,110,331 (1977).
References
- ^ Porto GG, Vasconcelos BC, Gomes AC, Albert D (2007). "Evaluation of lidocaine and mepivacaine for inferior third molar surgery" (PDF). Med Oral Patol Oral Cir Bucal. 12 (1): E60–4. PMID 17195831.
{{cite journal}}
: Unknown parameter|month=
ignored (help)CS1 maint: multiple names: authors list (link) - ^ Burm AG, Cohen IM, van Kleef JW, Vletter AA, Olieman W, Groen K (1997). "Pharmacokinetics of the enantiomers of mepivacaine after intravenous administration of the racemate in volunteers". Anesth. Analg. 84 (1): 85–9. doi:10.1097/00000539-199701000-00016. PMID 8989005.
{{cite journal}}
: Unknown parameter|month=
ignored (help)CS1 maint: multiple names: authors list (link)
External links