Content deleted Content added
Activating IUPHAR link. Report errors and suggestions to User_talk:BogBot |
m Infobox drug: rm/replace deprecated params. Fix unk parameters (rm some Chembox-params) (via AWB script) |
||
Line 3: | Line 3: | ||
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
||
| image = Hexylcaine.PNG |
| image = Hexylcaine.PNG |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
Line 9: | Line 8: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
Line 15: | Line 13: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = <10 minutes |
| elimination_half-life = <10 minutes |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 7196 |
| IUPHAR_ligand = 7196 |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 532-77-4 |
| CAS_number = 532-77-4 |
||
Line 26: | Line 22: | ||
| PubChem = 10770 |
| PubChem = 10770 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB00473 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 10315 |
| ChemSpiderID = 10315 |
||
Line 35: | Line 31: | ||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 1197 |
| ChEMBL = 1197 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=16 | H=23 | N=1 | O=2 |
| C=16 | H=23 | N=1 | O=2 |
||
| molecular_weight = 261.359 g/mol |
| molecular_weight = 261.359 g/mol |
||
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
Revision as of 10:16, 28 June 2015
Clinical data | |
---|---|
ATC code |
|
Pharmacokinetic data | |
Elimination half-life | <10 minutes |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
IUPHAR/BPS | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C16H23NO2 |
Molar mass | 261.359 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Hexylcaine hydrochloride, also called cyclaine (Merck) or osmocaine, is a short-acting local anesthetic. It acts by inhibiting sodium channel conduction. Overdose can lead to headache, tinnitus, numbness and tingling around the mouth and tongue, convulsions, inability to breathe, and decreased heart function.
References