Content deleted Content added
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 4: | Line 4: | ||
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
||
| image = Hexylcaine.PNG |
| image = Hexylcaine.PNG |
||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 10315 |
| ChemSpiderID = 10315 |
||
Line 10: | Line 31: | ||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = C14172 |
| KEGG = C14172 |
||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
||
⚫ | |||
| InChIKey = DKLKMKYDWHYZTD-UHFFFAOYAY |
| InChIKey = DKLKMKYDWHYZTD-UHFFFAOYAY |
||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
| StdInChI = 1S/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = DKLKMKYDWHYZTD-UHFFFAOYSA-N |
| StdInChIKey = DKLKMKYDWHYZTD-UHFFFAOYSA-N |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''Hexylcaine hydrochloride''', also called '''cyclaine''' ([[Merck & Co.|Merck]]) or '''osmocaine''', is a short-acting [[local anesthetic]]. It acts by inhibiting [[sodium channel]] conduction. Overdose can lead to [[headache]], [[tinnitus]], [[paresthesia|numbness and tingling]] around the mouth and tongue, [[convulsion]]s, [[respiratory arrest|inability to breathe]], and decreased heart function. |
'''Hexylcaine hydrochloride''', also called '''cyclaine''' ([[Merck & Co.|Merck]]) or '''osmocaine''', is a short-acting [[local anesthetic]]. It acts by inhibiting [[sodium channel]] conduction. Overdose can lead to [[headache]], [[tinnitus]], [[paresthesia|numbness and tingling]] around the mouth and tongue, [[convulsion]]s, [[respiratory arrest|inability to breathe]], and decreased heart function. |
Revision as of 21:50, 30 August 2011
Clinical data | |
---|---|
ATC code |
|
Pharmacokinetic data | |
Elimination half-life | <10 minutes |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C16H23NO2 |
Molar mass | 261.359 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Hexylcaine hydrochloride, also called cyclaine (Merck) or osmocaine, is a short-acting local anesthetic. It acts by inhibiting sodium channel conduction. Overdose can lead to headache, tinnitus, numbness and tingling around the mouth and tongue, convulsions, inability to breathe, and decreased heart function.