Content deleted Content added
Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI SMILES InChIKey UNII. |
Updating {{drugbox}} (no changed fields - added verified revid - updated 'CASNo_Ref', 'UNII_Ref') per Chem/Drugbox validation (report errors or [[user |
||
Line 1: | Line 1: | ||
{{Unreferenced stub|auto=yes|date=December 2009}} |
{{Unreferenced stub|auto=yes|date=December 2009}} |
||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = 390483162 |
|||
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
| IUPAC_name = 1-cyclohexylaminopropan-2-yl benzoate |
||
| image = Hexylcaine.PNG |
| image = Hexylcaine.PNG |
||
| ChemSpiderID = 10315 |
| ChemSpiderID = 10315 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 511IU0826Z |
| UNII = 511IU0826Z |
||
| InChI = 1/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
| InChI = 1/C16H23NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3 |
||
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
| smiles = O=C(OC(CNC1CCCCC1)C)c2ccccc2 |
||
| InChIKey = DKLKMKYDWHYZTD-UHFFFAOYAY |
| InChIKey = DKLKMKYDWHYZTD-UHFFFAOYAY |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number = 532-77-4 |
| CAS_number = 532-77-4 |
||
| ATC_prefix = none |
| ATC_prefix = none |
Revision as of 12:13, 13 October 2010
Clinical data | |
---|---|
ATC code |
|
Pharmacokinetic data | |
Elimination half-life | <10 minutes |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C16H23NO2 |
Molar mass | 261.359 g/mol g·mol−1 |
3D model (JSmol) | |
| |
(verify) |
Hexylcaine hydrochloride, also called cyclaine (Merck) or osmocaine, is a short-acting local anesthetic. It acts by inhibiting sodium channel conduction. Overdose can lead to headache, tinnitus, numbness and tingling around the mouth and tongue, convulsions, inability to breathe, and decreased heart function.