Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[u |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1:
{{Unreferenced|date=December 2009}}
{{Drugbox
| verifiedrevid = 443820414
| IUPAC_name = 5-Fluoro-1-[4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1H-pyrimidine-2,4-dione
| image = Floxuridine.png
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|monograph|floxuridine}}
| MedlinePlus = a682006
| pregnancy_category = ▼
| legal_status = ▼
<!--Pharmacokinetic data-->
| bioavailability = ▼
| protein_bound = ▼
| metabolism = ▼
| elimination_half-life = ▼
<!--Identifiers-->
| CAS_number = 50-91-9▼
| ATC_prefix = none▼
| ATC_suffix = ▼
| ATC_supplemental = ▼
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}▼
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5586
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 039LU44I5M
| KEGG_Ref = {{keggcite|correct|kegg}}▼
| InChI = 1/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1▼
| KEGG = D04197▼
| smiles = FC=1C(=O)NC(=O)N(C=1)[C@@H]2O[C@@H]([C@@H](O)C2)CO▼
| ChEBI_Ref = {{ebicite|correct|EBI}}▼
| InChIKey = ODKNJVUHOIMIIZ-RRKCRQDMBI▼
| ChEBI = 60761▼
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 917
<!--Chemical data-->
| C=9 | H=11 | F=1 | N=2 | O=5 ▼
▲| smiles = FC=1C(=O)NC(=O)N(C=1)[C@@H]2O[C@@H]([C@@H](O)C2)CO
▲| InChI = 1/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1
▲| InChIKey = ODKNJVUHOIMIIZ-RRKCRQDMBI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ODKNJVUHOIMIIZ-RRKCRQDMSA-N
}}
▲| CAS_number = 50-91-9
▲| CASNo_Ref = {{cascite|correct|CAS}}
▲| ATC_prefix = none
▲| ATC_suffix =
▲| ATC_supplemental =
▲| ChEBI_Ref = {{ebicite|correct|EBI}}
▲| ChEBI = 60761
▲| PubChem = 5790
▲| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
▲| DrugBank = APRD00692
▲| KEGG_Ref = {{keggcite|correct|kegg}}
▲| KEGG = D04197
▲| C=9 | H=11 | F=1 | N=2 | O=5
▲| molecular_weight = 246.192 g/mol
▲| bioavailability =
▲| protein_bound =
▲| metabolism =
▲| elimination_half-life =
▲| pregnancy_category =
▲| legal_status =
▲| routes_of_administration = }}
'''Floxuridine''' is an [[oncology]] drug that belongs to the class known as [[antimetabolite]]s. The drug is most often used in the treatment of colorectal cancer.
|
Revision as of 07:59, 30 August 2011
Clinical data | |
---|---|
AHFS/Drugs.com | Monograph |
MedlinePlus | a682006 |
ATC code |
|
Legal status | |
Legal status | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.000.066 |
Chemical and physical data | |
Formula | C9H11FN2O5 |
Molar mass | 246.192 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Floxuridine is an oncology drug that belongs to the class known as antimetabolites. The drug is most often used in the treatment of colorectal cancer.
Pharmacology
Floxuridine, an analog of 5-fluorouracil, is a fluorinated pyrimidine.
Mechanism of action
Floxuridine works because it is broken down by the body into its active form, which is the same as a metabolite of 5-Fluorouracil.
History
Floxuridine first gained FDA approval in December 1970 under the brand name FUDR. The drug was initially marketed by Roche, which also did a lot of the initial work on 5-fluorouracil. The National Cancer Institute was an early developer of the drug. Roche sold its FUDR product line in 2001 to F H Faulding, which became Mayne Pharma.
Suppliers
In the US the drug is supplied by APP Pharmaceuticals, LLC; Hospira, Inc.; and Bedford Laboratories.
- ^ "FDA-sourced list of all drugs with black box warnings (Use Download Full Results and View Query links.)". nctr-crs.fda.gov. FDA. Retrieved 22 Oct 2023.