24.141.8.198 (talk) No edit summary |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1:
{{Drugbox
| IUPAC_name = 3-(2-[Isopropyl(methyl)amino]ethyl)-1H-indol-4-ol
| image = Miprocin.png
| image2 = 4-HO-MiPT-3d-sticks.png▼
| width = 140
▲| image2 = 4-HO-MiPT-3d-sticks.png
| width2 = 160
<!--Clinical data-->
| tradename =
| pregnancy_AU = ▼
| pregnancy_US = ▼
| pregnancy_category = ▼
| legal_AU = ▼
| legal_CA = ▼
| legal_UK = ▼
| legal_US = ▼
| legal_status = ▼
| routes_of_administration = ▼
<!--Pharmacokinetic data-->
| bioavailability = ▼
| protein_bound = ▼
| metabolism = ▼
| elimination_half-life = ▼
| excretion = ▼
<!--Identifiers-->
| CAS_number = 77872-43-6▼
| ATC_prefix = ▼
| ATC_suffix = ▼
| PubChem = 10082683▼
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8258221
| InChI = 1/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3▼
| InChIKey = RXKGHZCQFXXWFQ-UHFFFAOYAV▼
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 171419
<!--Chemical data-->
| C=14 | H=20 | N=2 | O=1 ▼
| molecular_weight = 232.32 g/mol▼
| smiles = CN(C(C)C)CCC2=CNC1=CC=CC(O)=C12▼
▲| InChI = 1/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3
▲| InChIKey = RXKGHZCQFXXWFQ-UHFFFAOYAV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RXKGHZCQFXXWFQ-UHFFFAOYSA-N
▲| CAS_number = 77872-43-6
▲| ATC_prefix =
▲| ATC_suffix =
▲| PubChem = 10082683
▲| C=14 | H=20 | N=2 | O=1
▲| molecular_weight = 232.32 g/mol
▲| smiles = CN(C(C)C)CCC2=CNC1=CC=CC(O)=C12
| melting_point = 123
| melting_high = 125
▲| bioavailability =
▲| protein_bound =
▲| metabolism =
▲| elimination_half-life =
▲| excretion =
▲| pregnancy_AU =
▲| pregnancy_US =
▲| pregnancy_category =
▲| legal_AU =
▲| legal_CA =
▲| legal_UK =
▲| legal_US =
▲| legal_status =
▲| routes_of_administration =
}}
|
Revision as of 03:30, 30 August 2011
Identifiers | |
---|---|
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C14H20N2O |
Molar mass | 232.32 g/mol g·mol−1 |
3D model (JSmol) | |
Melting point | 123 to 125 °C (253 to 257 °F) |
| |
| |
(verify) |
4-HO-MiPT, or 4-hydroxy-N-methyl-N-isopropyltryptamine is a lesser-known psychedelic drug from the tryptamine family. It is also known as Miprocin. It is the 4-hydroxyl analog of MiPT. 4-HO-MiPT was first synthesized by Alexander Shulgin. In his book TIHKAL (Tryptamines I Have Known and Loved), the dosage range is listed as 12-25 mgs, and the duration listed as 4-6 hours, although other sources list the duration as 5-8 hours. 4-HO-MiPT produces vivid and intense closed-eye imagery, enhancement of the senses, time and spatial distortion, and out-of-body experiences. In general, these effects resemble those of other tryptamines, including LSD and psilocin. There have been no reports of deaths from 4-HO-MiPT.
Law
4-HO-MIPT is unscheduled in the United States.