Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI'). |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1: | Line 1: | ||
{{ |
{{Drugbox |
||
| verifiedrevid = 411377452 |
| verifiedrevid = 411377452 |
||
| IUPAC_name = 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| IUPAC_name = 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
||
| Other_name = 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-[1,8]naphthyridine-3-carboxylic acid |
|||
| image = Enoxacin.svg |
| image = Enoxacin.svg |
||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|monograph|oxistat}} |
|||
| MedlinePlus = a601013 |
|||
⚫ | |||
<!--Identifiers--> |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 3116 |
| ChemSpiderID = 3116 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 325OGW249P |
| UNII = 325OGW249P |
||
⚫ | |||
⚫ | |||
⚫ | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 826 |
| ChEMBL = 826 |
||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
| smiles = Fc1c(nc2c(c1)C(=O)C(\C(=O)O)=C/N2CC)N3CCNCC3 |
| smiles = Fc1c(nc2c(c1)C(=O)C(\C(=O)O)=C/N2CC)N3CCNCC3 |
||
⚫ | |||
| InChIKey = IDYZIJYBMGIQMJ-UHFFFAOYAG |
| InChIKey = IDYZIJYBMGIQMJ-UHFFFAOYAG |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
Line 18: | Line 37: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
| StdInChIKey = IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
||
⚫ | |||
⚫ | |||
⚫ | |||
| ATC_supplemental = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| pregnancy_category = |
|||
| legal_status = |
|||
⚫ | |||
}} |
}} |
||
'''Enoxacin''' (sold under the following trade names '''Almitil''', '''Bactidan''', '''Bactidron''', '''Comprecin''', '''Enoksetin''', '''Enoxen''', '''Enroxil''', '''Enoxin''', '''Enoxor''', '''Flumark''', '''Penetrex''', '''Gyramid''', '''Vinone''') is an oral broad-spectrum [[fluoroquinolone]] [[antibacterial]] agent used in the treatment of [[urinary tract infection]]s and [[gonorrhea]]. [[Insomnia]] is a common adverse effect.<ref>{{Cite journal | last1 = Rafalsky | first1 = V. | last2 = Andreeva | first2 = I. | last3 = Rjabkova | first3 = E. | last4 = Rafalsky | first4 = Vladimir V | title = Quinolones for uncomplicated acute cystitis in women. | journal = Cochrane Database Syst Rev | volume = 3 | issue = | pages = CD003597 | month = | year = 2006 | doi = 10.1002/14651858.CD003597.pub2 | pmid = 16856014 | DUPLICATE DATA: pmid=16856014}}</ref><ref>{{Cite journal | last1 = Mogabgab | first1 = WJ. | title = Recent developments in the treatment of sexually transmitted diseases. | journal = Am J Med | volume = 91 | issue = 6A | pages = 140S–144S | month = Dec | year = 1991 | doi = 10.1016/0002-9343(91)90327-T| pmid = 1767802 }}</ref> It is no longer available in the [[United States]]. |
'''Enoxacin''' (sold under the following trade names '''Almitil''', '''Bactidan''', '''Bactidron''', '''Comprecin''', '''Enoksetin''', '''Enoxen''', '''Enroxil''', '''Enoxin''', '''Enoxor''', '''Flumark''', '''Penetrex''', '''Gyramid''', '''Vinone''') is an oral broad-spectrum [[fluoroquinolone]] [[antibacterial]] agent used in the treatment of [[urinary tract infection]]s and [[gonorrhea]]. [[Insomnia]] is a common adverse effect.<ref>{{Cite journal | last1 = Rafalsky | first1 = V. | last2 = Andreeva | first2 = I. | last3 = Rjabkova | first3 = E. | last4 = Rafalsky | first4 = Vladimir V | title = Quinolones for uncomplicated acute cystitis in women. | journal = Cochrane Database Syst Rev | volume = 3 | issue = | pages = CD003597 | month = | year = 2006 | doi = 10.1002/14651858.CD003597.pub2 | pmid = 16856014 | DUPLICATE DATA: pmid=16856014}}</ref><ref>{{Cite journal | last1 = Mogabgab | first1 = WJ. | title = Recent developments in the treatment of sexually transmitted diseases. | journal = Am J Med | volume = 91 | issue = 6A | pages = 140S–144S | month = Dec | year = 1991 | doi = 10.1016/0002-9343(91)90327-T| pmid = 1767802 }}</ref> It is no longer available in the [[United States]]. |
Revision as of 22:06, 30 August 2011
Clinical data | |
---|---|
AHFS/Drugs.com | Monograph |
MedlinePlus | a601013 |
Routes of administration | Oral |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C15H17FN4O3 |
Molar mass | 320.319 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Enoxacin (sold under the following trade names Almitil, Bactidan, Bactidron, Comprecin, Enoksetin, Enoxen, Enroxil, Enoxin, Enoxor, Flumark, Penetrex, Gyramid, Vinone) is an oral broad-spectrum fluoroquinolone antibacterial agent used in the treatment of urinary tract infections and gonorrhea. Insomnia is a common adverse effect.[1][2] It is no longer available in the United States.
References
- ^ Rafalsky, V.; Andreeva, I.; Rjabkova, E.; Rafalsky, Vladimir V (2006). "Quinolones for uncomplicated acute cystitis in women". Cochrane Database Syst Rev. 3: CD003597. doi:10.1002/14651858.CD003597.pub2. PMID 16856014.
{{cite journal}}
: Cite has empty unknown parameter:|month=
(help); Unknown parameter|DUPLICATE DATA: pmid=
ignored (help) - ^ Mogabgab, WJ. (1991). "Recent developments in the treatment of sexually transmitted diseases". Am J Med. 91 (6A): 140S–144S. doi:10.1016/0002-9343(91)90327-T. PMID 1767802.
{{cite journal}}
: Unknown parameter|month=
ignored (help)
Additional reading
- Patel, SS; Spencer, CM (1996). "Enoxacin: a reappraisal of its clinical efficacy in the treatment of genitourinary tract infections". Drugs. 51 (1): 137–60. PMID 8741236.
{{cite journal}}
: Cite has empty unknown parameter:|author-name-separator=
(help); Unknown parameter|author-separator=
ignored (help); Unknown parameter|month=
ignored (help).
External links