WikitanvirBot (talk | contribs) m r2.7.1) (robot Adding: ca:Sulfat dermatà |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1: | Line 1: | ||
{{Drugbox |
{{Drugbox |
||
| verifiedrevid = 396326532 |
| verifiedrevid = 396326532 |
||
⚫ | |||
| IUPAC_name = |
|||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = |
|||
| Drugs.com = {{drugs.com|international|dermatan-sulfate}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 30361 |
| ChemSpiderID = 30361 |
||
⚫ | |||
<!--Chemical data--> |
|||
| smiles = [O-]C(=O)[C@@H]2O[C@@H](O[C@H]1[C@@H](OS([O-])(=O)=O)[C@H](O[C@@H](O)[C@@H]1NC(=O)C)CO)[C@H](O)[C@@H](O)[C@@H]2O |
| smiles = [O-]C(=O)[C@@H]2O[C@@H](O[C@H]1[C@@H](OS([O-])(=O)=O)[C@H](O[C@@H](O)[C@@H]1NC(=O)C)CO)[C@H](O)[C@@H](O)[C@@H]2O |
||
⚫ | |||
| InChIKey = AVJBPWGFOQAPRH-SRMSFAINBD |
| InChIKey = AVJBPWGFOQAPRH-SRMSFAINBD |
||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C14H23NO15S/c1-3(17)15-5-10(9(30-31(24,25)26)4(2-16)27-13(5)23)28-14-8(20)6(18)7(19)11(29-14)12(21)22/h4-11,13-14,16,18-20,23H,2H2,1H3,(H,15,17)(H,21,22)(H,24,25,26)/p-2/t4-,5-,6+,7+,8-,9+,10-,11-,13-,14-/m1/s1 |
| StdInChI = 1S/C14H23NO15S/c1-3(17)15-5-10(9(30-31(24,25)26)4(2-16)27-13(5)23)28-14-8(20)6(18)7(19)11(29-14)12(21)22/h4-11,13-14,16,18-20,23H,2H2,1H3,(H,15,17)(H,21,22)(H,24,25,26)/p-2/t4-,5-,6+,7+,8-,9+,10-,11-,13-,14-/m1/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = AVJBPWGFOQAPRH-FWMKGIEWSA-L |
| StdInChIKey = AVJBPWGFOQAPRH-FWMKGIEWSA-L |
||
⚫ | |||
⚫ | |||
⚫ | |||
| PubChem = |
|||
| DrugBank = |
|||
| chemical_formula = |
|||
| molecular_weight = |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
⚫ | |||
⚫ | |||
| pregnancy_category= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| legal_status = |
|||
| routes_of_administration = |
|||
}} |
}} |
||
'''Dermatan sulfate''' is a [[glycosaminoglycan]] (formerly called a mucopolysaccharide) found mostly in [[skin]], but also in [[blood vessels]], [[heart valves]], [[tendons]], and [[lungs]]. |
'''Dermatan sulfate''' is a [[glycosaminoglycan]] (formerly called a mucopolysaccharide) found mostly in [[skin]], but also in [[blood vessels]], [[heart valves]], [[tendons]], and [[lungs]]. |
Revision as of 20:44, 30 August 2011
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
CAS Number | |
ChemSpider | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.042.305 |
Chemical and physical data | |
3D model (JSmol) | |
| |
| |
(verify) |
Dermatan sulfate is a glycosaminoglycan (formerly called a mucopolysaccharide) found mostly in skin, but also in blood vessels, heart valves, tendons, and lungs.
It is also referred to as chondroitin sulfate B, [1] although it is no longer classified as a form of chondroitin sulfate by most sources.
Function
Dermatan sulfate may have roles in coagulation, cardiovascular disease, carcinogenesis, infection, wound repair, and fibrosis.[citation needed]
Pathology
Dermatan sulfate accumulates abnormally in several of the mucopolysaccharidosis disorders.
An excess of Dermatan Sulfate in the Mitral Valve is characteristic of myxomatous degeneration of the leaflets leading to redundancy of valve tissue and ultimately, Mitral Valve Prolapse (into the Left atrium) and insufficiency. This chronic prolapse occurs mainly in women over the age of 60, and can predispose the patient to mitral annular calcification. Mitral valve insufficiency can lead to eccentric (volume dependent or dilated) hypertrophy and eventually Left Heart failure if untreated.
See also
External links
- Dermatan+sulfate at the U.S. National Library of Medicine Medical Subject Headings (MeSH)
References
- ^ Trowbridge, JM (2002). "Dermatan sulfate: new functions from an old glycosaminoglycan". Glycobiology. 12 (9): 117R–25R. doi:10.1093/glycob/cwf066. PMID 12213784.
{{cite journal}}
: Unknown parameter|coauthors=
ignored (|author=
suggested) (help); Unknown parameter|month=
ignored (help)