24.141.8.198 (talk) No edit summary |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1: | Line 1: | ||
{{Drugbox |
|||
| verifiedrevid = 408391581 |
|||
| |
|||
| IUPAC_name = 3-(2-[Isopropyl(methyl)amino]ethyl)-1H-indol-4-ol |
| IUPAC_name = 3-(2-[Isopropyl(methyl)amino]ethyl)-1H-indol-4-ol |
||
| image = Miprocin.png |
| image = Miprocin.png |
||
⚫ | |||
| width = 140 |
| width = 140 |
||
⚫ | |||
| width2 = 160 |
| width2 = 160 |
||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 8258221 |
| ChemSpiderID = 8258221 |
||
⚫ | |||
| smiles1 = Oc1cccc2c1c(cn2)CCN(C(C)C)C |
|||
⚫ | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 171419 |
| ChEMBL = 171419 |
||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3 |
| StdInChI = 1S/C14H20N2O/c1-10(2)16(3)8-7-11-9-15-12-5-4-6-13(17)14(11)12/h4-6,9-10,15,17H,7-8H2,1-3H3 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = RXKGHZCQFXXWFQ-UHFFFAOYSA-N |
| StdInChIKey = RXKGHZCQFXXWFQ-UHFFFAOYSA-N |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| melting_point = 123 |
| melting_point = 123 |
||
| melting_high = 125 |
| melting_high = 125 |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
Revision as of 03:30, 30 August 2011
Identifiers | |
---|---|
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C14H20N2O |
Molar mass | 232.32 g/mol g·mol−1 |
3D model (JSmol) | |
Melting point | 123 to 125 °C (253 to 257 °F) |
| |
| |
(verify) |
4-HO-MiPT, or 4-hydroxy-N-methyl-N-isopropyltryptamine is a lesser-known psychedelic drug from the tryptamine family. It is also known as Miprocin. It is the 4-hydroxyl analog of MiPT. 4-HO-MiPT was first synthesized by Alexander Shulgin. In his book TIHKAL (Tryptamines I Have Known and Loved), the dosage range is listed as 12-25 mgs, and the duration listed as 4-6 hours, although other sources list the duration as 5-8 hours. 4-HO-MiPT produces vivid and intense closed-eye imagery, enhancement of the senses, time and spatial distortion, and out-of-body experiences. In general, these effects resemble those of other tryptamines, including LSD and psilocin. There have been no reports of deaths from 4-HO-MiPT.
Law
4-HO-MIPT is unscheduled in the United States.